C20H19N3O3S2 — CID 5229385
N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methylbenzamide (PubChem CID 5229385) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methylbenzamide.
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 5229385 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]-4-methylbenzamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H19N3O3S2/c1-12-4-6-13(7-5-12)18(24)22-19(27)23-20-21-15(11-28-20)14-8-9-16(25-2)17(10-14)26-3/h4-11H,1-3H3,(H2,21,22,23,24,27) |
| InChIKey | UHVGYUMEDMXAGY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|