C23H19N3O3S2 — CID 2294024
N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 2294024) has the molecular formula C23H19N3O3S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 2294024 |
| Molecular Formula | C23H19N3O3S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | N-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)c3cccc4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C23H19N3O3S2/c1-28-19-11-10-15(12-20(19)29-2)18-13-31-23(24-18)26-22(30)25-21(27)17-9-5-7-14-6-3-4-8-16(14)17/h3-13H,1-2H3,(H2,24,25,26,27,30) |
| InChIKey | QJMGVLPJPYTFDO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|