C21H20FN3O3S2 — CID 54860441
2-(3,5-dimethylphenoxy)-N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]acetamide (PubChem CID 54860441) has the molecular formula C21H20FN3O3S2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 54860441 |
| Molecular Formula | C21H20FN3O3S2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-[[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]carbamothioyl]acetamide |
| SMILES | COc1ccc(-c2csc(NC(=S)NC(=O)COc3cc(C)cc(C)c3)n2)cc1F |
| InChI | InChI=1S/C21H20FN3O3S2/c1-12-6-13(2)8-15(7-12)28-10-19(26)24-20(29)25-21-23-17(11-30-21)14-4-5-18(27-3)16(22)9-14/h4-9,11H,10H2,1-3H3,(H2,23,24,25,26,29) |
| InChIKey | OEUAECUEWLIMEE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|