C11H11NOS — CID 136992886
2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenol (PubChem CID 136992886) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenol.
| Compound Name | 2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenol |
|---|---|
| PubChem CID | 136992886 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-methyl-4-(4-methyl-1,3-thiazol-2-yl)phenol |
| SMILES | Cc1csc(-c2ccc(O)c(C)c2)n1 |
| InChI | InChI=1S/C11H11NOS/c1-7-5-9(3-4-10(7)13)11-12-8(2)6-14-11/h3-6,13H,1-2H3 |
| InChIKey | VGDBFSAVQFCBHD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |