C14H11N3S — CID 22049802
4-(4-methyl-3-pyridinyl)-2-pyridin-4-yl-1,3-thiazole (PubChem CID 22049802) has the molecular formula C14H11N3S and a molecular weight of 253.33 g/mol. Its IUPAC name is 4-(4-methyl-3-pyridinyl)-2-pyridin-4-yl-1,3-thiazole.
| Compound Name | 4-(4-methyl-3-pyridinyl)-2-pyridin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 22049802 |
| Molecular Formula | C14H11N3S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4-(4-methyl-3-pyridinyl)-2-pyridin-4-yl-1,3-thiazole |
| SMILES | Cc1ccncc1-c1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C14H11N3S/c1-10-2-5-16-8-12(10)13-9-18-14(17-13)11-3-6-15-7-4-11/h2-9H,1H3 |
| InChIKey | YPSCEIZQQIFJTE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |