C20H31N3O4 — CID 91585765
4-[[8-(4-carbamoylanilino)-8-oxooctyl]-methylamino]butanoic acid (PubChem CID 91585765) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[[8-(4-carbamoylanilino)-8-oxooctyl]-methylamino]butanoic acid.
| Compound Name | 4-[[8-(4-carbamoylanilino)-8-oxooctyl]-methylamino]butanoic acid |
|---|---|
| PubChem CID | 91585765 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 4-[[8-(4-carbamoylanilino)-8-oxooctyl]-methylamino]butanoic acid |
| SMILES | CN(CCCCCCCC(=O)Nc1ccc(C(N)=O)cc1)CCCC(=O)O |
| InChI | InChI=1S/C20H31N3O4/c1-23(15-7-9-19(25)26)14-6-4-2-3-5-8-18(24)22-17-12-10-16(11-13-17)20(21)27/h10-13H,2-9,14-15H2,1H3,(H2,21,27)(H,22,24)(H,25,26) |
| InChIKey | GKDZYGVQCPRUBM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|