C24H27N3O6 — CID 102334177
methyl 6-[[4-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]benzoyl]amino]hexanoate (PubChem CID 102334177) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is methyl 6-[[4-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]benzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[4-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102334177 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | methyl 6-[[4-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]benzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1 |
| InChI | InChI=1S/C24H27N3O6/c1-16(28)26-20-9-6-5-8-19(20)22(30)24(32)27-18-13-11-17(12-14-18)23(31)25-15-7-3-4-10-21(29)33-2/h5-6,8-9,11-14H,3-4,7,10,15H2,1-2H3,(H,25,31)(H,26,28)(H,27,32) |
| InChIKey | SJMVPTALAWSUTM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|