C20H24N2O3 — CID 143694562
2-(2-acetamidophenyl)-N-(4-ethylphenyl)-2-oxoacetamide;ethane (PubChem CID 143694562) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(2-acetamidophenyl)-N-(4-ethylphenyl)-2-oxoacetamide;ethane.
| Compound Name | 2-(2-acetamidophenyl)-N-(4-ethylphenyl)-2-oxoacetamide;ethane |
|---|---|
| PubChem CID | 143694562 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-(2-acetamidophenyl)-N-(4-ethylphenyl)-2-oxoacetamide;ethane |
| SMILES | CC.CCc1ccc(NC(=O)C(=O)c2ccccc2NC(C)=O)cc1 |
| InChI | InChI=1S/C18H18N2O3.C2H6/c1-3-13-8-10-14(11-9-13)20-18(23)17(22)15-6-4-5-7-16(15)19-12(2)21;1-2/h4-11H,3H2,1-2H3,(H,19,21)(H,20,23);1-2H3 |
| InChIKey | ACJNLXFIOYSEEL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|