C21H23N3O4 — CID 4061795
3-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-N-butylbenzamide (PubChem CID 4061795) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-N-butylbenzamide.
| Compound Name | 3-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-N-butylbenzamide |
|---|---|
| PubChem CID | 4061795 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[[2-(2-acetamidophenyl)-2-oxoacetyl]amino]-N-butylbenzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=O)C(=O)c2ccccc2NC(C)=O)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-3-4-12-22-20(27)15-8-7-9-16(13-15)24-21(28)19(26)17-10-5-6-11-18(17)23-14(2)25/h5-11,13H,3-4,12H2,1-2H3,(H,22,27)(H,23,25)(H,24,28) |
| InChIKey | VSVMLPQVOKWKNH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|