C19H20ClN3O2S — CID 17197199
N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-chlorobenzamide (PubChem CID 17197199) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-chlorobenzamide.
| Compound Name | N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 17197199 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[[3-(butylcarbamoyl)phenyl]carbamothioyl]-2-chlorobenzamide |
| SMILES | CCCCNC(=O)c1cccc(NC(=S)NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-2-3-11-21-17(24)13-7-6-8-14(12-13)22-19(26)23-18(25)15-9-4-5-10-16(15)20/h4-10,12H,2-3,11H2,1H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | SPHBRAHDEDXSOA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|