C26H39N3O5 — CID 145149268
ethane;1-methylpiperidine;(4-nitrophenyl) N-[[4-(2-methylpropoxy)phenyl]methyl]carbamate (PubChem CID 145149268) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is ethane;1-methylpiperidine;(4-nitrophenyl) N-[[4-(2-methylpropoxy)phenyl]methyl]carbamate.
| Compound Name | ethane;1-methylpiperidine;(4-nitrophenyl) N-[[4-(2-methylpropoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 145149268 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | ethane;1-methylpiperidine;(4-nitrophenyl) N-[[4-(2-methylpropoxy)phenyl]methyl]carbamate |
| SMILES | CC.CC(C)COc1ccc(CNC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1.CN1CCCCC1 |
| InChI | InChI=1S/C18H20N2O5.C6H13N.C2H6/c1-13(2)12-24-16-7-3-14(4-8-16)11-19-18(21)25-17-9-5-15(6-10-17)20(22)23;1-7-5-3-2-4-6-7;1-2/h3-10,13H,11-12H2,1-2H3,(H,19,21);2-6H2,1H3;1-2H3 |
| InChIKey | ANPJYUNDQYKKGL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|