C36H57N7O10 — CID 58760913
(4-nitrophenyl) 2,6-bis[2,3-bis(propanoylamino)hexanoylamino]hexanoate (PubChem CID 58760913) has the molecular formula C36H57N7O10 and a molecular weight of 747.89 g/mol. Its IUPAC name is (4-nitrophenyl) 2,6-bis[2,3-bis(propanoylamino)hexanoylamino]hexanoate.
| Compound Name | (4-nitrophenyl) 2,6-bis[2,3-bis(propanoylamino)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 58760913 |
| Molecular Formula | C36H57N7O10 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 747.42 |
| IUPAC Name | (4-nitrophenyl) 2,6-bis[2,3-bis(propanoylamino)hexanoylamino]hexanoate |
| SMILES | CCCC(NC(=O)CC)C(NC(=O)CC)C(=O)NCCCCC(NC(=O)C(NC(=O)CC)C(CCC)NC(=O)CC)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H57N7O10/c1-7-15-25(38-28(44)9-3)32(41-30(46)11-5)34(48)37-22-14-13-17-27(36(50)53-24-20-18-23(19-21-24)43(51)52)40-35(49)33(42-31(47)12-6)26(16-8-2)39-29(45)10-4/h18-21,25-27,32-33H,7-17,22H2,1-6H3,(H,37,48)(H,38,44)(H,39,45)(H,40,49)(H,41,46)(H,42,47) |
| InChIKey | GJOSONUKGHXVRO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 244.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|