C19H27Cl2N3O6 — CID 91173474
dichloromethane;(4-nitrophenyl) 2,3-bis(propanoylamino)hexanoate (PubChem CID 91173474) has the molecular formula C19H27Cl2N3O6 and a molecular weight of 464.35 g/mol. Its IUPAC name is dichloromethane;(4-nitrophenyl) 2,3-bis(propanoylamino)hexanoate.
| Compound Name | dichloromethane;(4-nitrophenyl) 2,3-bis(propanoylamino)hexanoate |
|---|---|
| PubChem CID | 91173474 |
| Molecular Formula | C19H27Cl2N3O6 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | dichloromethane;(4-nitrophenyl) 2,3-bis(propanoylamino)hexanoate |
| SMILES | CCCC(NC(=O)CC)C(NC(=O)CC)C(=O)Oc1ccc([N+](=O)[O-])cc1.ClCCl |
| InChI | InChI=1S/C18H25N3O6.CH2Cl2/c1-4-7-14(19-15(22)5-2)17(20-16(23)6-3)18(24)27-13-10-8-12(9-11-13)21(25)26;2-1-3/h8-11,14,17H,4-7H2,1-3H3,(H,19,22)(H,20,23);1H2 |
| InChIKey | QOXLOFNWLDFGMW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|