C14H17BrN2O6S — CID 87322013
(3R)-3-(2-bromo-6-nitrophenyl)sulfanyl-3-formamido-2-[(2-methylpropan-2-yl)oxy]propanoic acid (PubChem CID 87322013) has the molecular formula C14H17BrN2O6S and a molecular weight of 421.27 g/mol. Its IUPAC name is (3R)-3-(2-bromo-6-nitrophenyl)sulfanyl-3-formamido-2-[(2-methylpropan-2-yl)oxy]propanoic acid.
| Compound Name | (3R)-3-(2-bromo-6-nitrophenyl)sulfanyl-3-formamido-2-[(2-methylpropan-2-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 87322013 |
| Molecular Formula | C14H17BrN2O6S |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | (3R)-3-(2-bromo-6-nitrophenyl)sulfanyl-3-formamido-2-[(2-methylpropan-2-yl)oxy]propanoic acid |
| SMILES | CC(C)(C)OC(C(=O)O)[C@H](NC=O)Sc1c(Br)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN2O6S/c1-14(2,3)23-10(13(19)20)12(16-7-18)24-11-8(15)5-4-6-9(11)17(21)22/h4-7,10,12H,1-3H3,(H,16,18)(H,19,20)/t10?,12-/m1/s1 |
| InChIKey | MXGCNGOUAHKNNL-TVKKRMFBSA-N |
| XLogP | 2.79 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|