C17H23N3O8 — CID 175359466
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(6-nitro-1,3-benzodioxol-5-yl)ethylamino]propanoic acid (PubChem CID 175359466) has the molecular formula C17H23N3O8 and a molecular weight of 397.38 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(6-nitro-1,3-benzodioxol-5-yl)ethylamino]propanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(6-nitro-1,3-benzodioxol-5-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 175359466 |
| Molecular Formula | C17H23N3O8 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-(6-nitro-1,3-benzodioxol-5-yl)ethylamino]propanoic acid |
| SMILES | CC(NC[C@H](NC(=O)OC(C)(C)C)C(=O)O)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H23N3O8/c1-9(10-5-13-14(27-8-26-13)6-12(10)20(24)25)18-7-11(15(21)22)19-16(23)28-17(2,3)4/h5-6,9,11,18H,7-8H2,1-4H3,(H,19,23)(H,21,22)/t9?,11-/m0/s1 |
| InChIKey | JRVXKZYTHJCIML-UMJHXOGRSA-N |
| XLogP | 1.95 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|