C9H10ClF2N3O3 — CID 103081481
5-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-3-nitropyridin-2-amine (PubChem CID 103081481) has the molecular formula C9H10ClF2N3O3 and a molecular weight of 281.65 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-3-nitropyridin-2-amine.
| Compound Name | 5-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 103081481 |
| Molecular Formula | C9H10ClF2N3O3 |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 5-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1NCCOCC(F)F |
| InChI | InChI=1S/C9H10ClF2N3O3/c10-6-3-7(15(16)17)9(14-4-6)13-1-2-18-5-8(11)12/h3-4,8H,1-2,5H2,(H,13,14) |
| InChIKey | ZOWCAMVXTWJUAJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|