C9H16N6O4S — CID 106343280
2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]-N-methylethanesulfonamide (PubChem CID 106343280) has the molecular formula C9H16N6O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]-N-methylethanesulfonamide.
| Compound Name | 2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 106343280 |
| Molecular Formula | C9H16N6O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]-N-methylethanesulfonamide |
| SMILES | CCNc1ncc([N+](=O)[O-])c(NCCS(=O)(=O)NC)n1 |
| InChI | InChI=1S/C9H16N6O4S/c1-3-11-9-13-6-7(15(16)17)8(14-9)12-4-5-20(18,19)10-2/h6,10H,3-5H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | DDRVRJYZDZRRAP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|