C11H19N5O3S — CID 106311779
3-[2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311779) has the molecular formula C11H19N5O3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-[2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311779 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-[2-[[2-(ethylamino)-5-nitropyrimidin-4-yl]amino]ethylsulfanyl]propan-1-ol |
| SMILES | CCNc1ncc([N+](=O)[O-])c(NCCSCCCO)n1 |
| InChI | InChI=1S/C11H19N5O3S/c1-2-12-11-14-8-9(16(18)19)10(15-11)13-4-7-20-6-3-5-17/h8,17H,2-7H2,1H3,(H2,12,13,14,15) |
| InChIKey | DWBVHODBZABMAW-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|