C14H21NO4S2 — CID 81041514
N-[(1,1-dioxothiolan-2-yl)methyl]-2-propylsulfonylaniline (PubChem CID 81041514) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-2-propylsulfonylaniline.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-propylsulfonylaniline |
|---|---|
| PubChem CID | 81041514 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-propylsulfonylaniline |
| SMILES | CCCS(=O)(=O)c1ccccc1NCC1CCCS1(=O)=O |
| InChI | InChI=1S/C14H21NO4S2/c1-2-9-21(18,19)14-8-4-3-7-13(14)15-11-12-6-5-10-20(12,16)17/h3-4,7-8,12,15H,2,5-6,9-11H2,1H3 |
| InChIKey | WTGFNUQHPVPELG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |