C12H17N3O — CID 109222760
5-(cyclopropylamino)-N-propylpyridine-3-carboxamide (PubChem CID 109222760) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-(cyclopropylamino)-N-propylpyridine-3-carboxamide.
| Compound Name | 5-(cyclopropylamino)-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109222760 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 5-(cyclopropylamino)-N-propylpyridine-3-carboxamide |
| SMILES | CCCNC(=O)c1cncc(NC2CC2)c1 |
| InChI | InChI=1S/C12H17N3O/c1-2-5-14-12(16)9-6-11(8-13-7-9)15-10-3-4-10/h6-8,10,15H,2-5H2,1H3,(H,14,16) |
| InChIKey | IDQSGRVBMFXOKC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |