C17H19N3O — CID 109223789
5-(cyclopropylamino)-N-(2-phenylethyl)pyridine-3-carboxamide (PubChem CID 109223789) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-(cyclopropylamino)-N-(2-phenylethyl)pyridine-3-carboxamide.
| Compound Name | 5-(cyclopropylamino)-N-(2-phenylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109223789 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 5-(cyclopropylamino)-N-(2-phenylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cncc(NC2CC2)c1 |
| InChI | InChI=1S/C17H19N3O/c21-17(19-9-8-13-4-2-1-3-5-13)14-10-16(12-18-11-14)20-15-6-7-15/h1-5,10-12,15,20H,6-9H2,(H,19,21) |
| InChIKey | NUFUHNFKSGLUMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |