C18H28BrN — CID 107572198
N-(4-bromo-3,5-dimethylphenyl)-4-propylcycloheptan-1-amine (PubChem CID 107572198) has the molecular formula C18H28BrN and a molecular weight of 338.33 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-4-propylcycloheptan-1-amine.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-4-propylcycloheptan-1-amine |
|---|---|
| PubChem CID | 107572198 |
| Molecular Formula | C18H28BrN |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-4-propylcycloheptan-1-amine |
| SMILES | CCCC1CCCC(Nc2cc(C)c(Br)c(C)c2)CC1 |
| InChI | InChI=1S/C18H28BrN/c1-4-6-15-7-5-8-16(10-9-15)20-17-11-13(2)18(19)14(3)12-17/h11-12,15-16,20H,4-10H2,1-3H3 |
| InChIKey | GAHLSFFOKFYHGN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |