C15H20N4 — CID 163894875
2-N-(1H-indazol-5-yl)spiro[2.5]octane-2,6-diamine (PubChem CID 163894875) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-N-(1H-indazol-5-yl)spiro[2.5]octane-2,6-diamine.
| Compound Name | 2-N-(1H-indazol-5-yl)spiro[2.5]octane-2,6-diamine |
|---|---|
| PubChem CID | 163894875 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-N-(1H-indazol-5-yl)spiro[2.5]octane-2,6-diamine |
| SMILES | NC1CCC2(CC1)CC2Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C15H20N4/c16-11-3-5-15(6-4-11)8-14(15)18-12-1-2-13-10(7-12)9-17-19-13/h1-2,7,9,11,14,18H,3-6,8,16H2,(H,17,19) |
| InChIKey | QESUQWBPVWCUJW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |