C13H16N4 — CID 67234298
N-(2-azabicyclo[2.2.1]heptan-4-yl)-1H-indazol-5-amine (PubChem CID 67234298) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is N-(2-azabicyclo[2.2.1]heptan-4-yl)-1H-indazol-5-amine.
| Compound Name | N-(2-azabicyclo[2.2.1]heptan-4-yl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 67234298 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | N-(2-azabicyclo[2.2.1]heptan-4-yl)-1H-indazol-5-amine |
| SMILES | c1cc2[nH]ncc2cc1NC12CCC(C1)NC2 |
| InChI | InChI=1S/C13H16N4/c1-2-12-9(7-15-17-12)5-10(1)16-13-4-3-11(6-13)14-8-13/h1-2,5,7,11,14,16H,3-4,6,8H2,(H,15,17) |
| InChIKey | AMJFHHVDSDFKPU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |