C20H20BrN3O3S — CID 73353692
3-[(4-bromophenyl)sulfamoyl]-N-(3-cyanocyclohexyl)benzamide (PubChem CID 73353692) has the molecular formula C20H20BrN3O3S and a molecular weight of 462.37 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfamoyl]-N-(3-cyanocyclohexyl)benzamide.
| Compound Name | 3-[(4-bromophenyl)sulfamoyl]-N-(3-cyanocyclohexyl)benzamide |
|---|---|
| PubChem CID | 73353692 |
| Molecular Formula | C20H20BrN3O3S |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | 3-[(4-bromophenyl)sulfamoyl]-N-(3-cyanocyclohexyl)benzamide |
| SMILES | N#CC1CCCC(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(Br)cc3)c2)C1 |
| InChI | InChI=1S/C20H20BrN3O3S/c21-16-7-9-17(10-8-16)24-28(26,27)19-6-2-4-15(12-19)20(25)23-18-5-1-3-14(11-18)13-22/h2,4,6-10,12,14,18,24H,1,3,5,11H2,(H,23,25) |
| InChIKey | VCUCHJVTPBKZRA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |