C16H16BrNO6S — CID 86807570
3-bromo-6-[(3,4-dimethoxyphenyl)sulfonylamino]-2-methylbenzoic acid (PubChem CID 86807570) has the molecular formula C16H16BrNO6S and a molecular weight of 430.28 g/mol. Its IUPAC name is 3-bromo-6-[(3,4-dimethoxyphenyl)sulfonylamino]-2-methylbenzoic acid.
| Compound Name | 3-bromo-6-[(3,4-dimethoxyphenyl)sulfonylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 86807570 |
| Molecular Formula | C16H16BrNO6S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | 3-bromo-6-[(3,4-dimethoxyphenyl)sulfonylamino]-2-methylbenzoic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(Br)c(C)c2C(=O)O)cc1OC |
| InChI | InChI=1S/C16H16BrNO6S/c1-9-11(17)5-6-12(15(9)16(19)20)18-25(21,22)10-4-7-13(23-2)14(8-10)24-3/h4-8,18H,1-3H3,(H,19,20) |
| InChIKey | VJGXUNHNJQWQAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |