N-(3-chloro-4-fluorophenyl)sulfamoyl chloride

C6H4Cl2FNO2S — CID 84760554

IUPACN-(3-chloro-4-fluorophenyl)sulfamoyl chloride
SMILESO=S(=O)(Cl)Nc1ccc(F)c(Cl)c1
InChIInChI=1S/C6H4Cl2FNO2S/c7-5-3-4(1-2-6(5)9)10-13(8,11)12/h1-3,10H
InChIKeyLMJILKRFGBIXPM-UHFFFAOYSA-N
MW244.07 g/mol
LogP2.37
Rot. Bonds2

About N-(3-chloro-4-fluorophenyl)sulfamoyl chloride

N-(3-chloro-4-fluorophenyl)sulfamoyl chloride (PubChem CID 84760554) has the molecular formula C6H4Cl2FNO2S and a molecular weight of 244.07 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-(3-chloro-4-fluorophenyl)sulfamoyl chloride
PubChem CID84760554
Molecular FormulaC6H4Cl2FNO2S
Molecular Weight244.07 g/mol
Exact Mass242.93
IUPAC NameN-(3-chloro-4-fluorophenyl)sulfamoyl chloride
SMILESO=S(=O)(Cl)Nc1ccc(F)c(Cl)c1
InChIInChI=1S/C6H4Cl2FNO2S/c7-5-3-4(1-2-6(5)9)10-13(8,11)12/h1-3,10H
InChIKeyLMJILKRFGBIXPM-UHFFFAOYSA-N
XLogP2.37
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.07
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-(3-chloro-4-fluorophenyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(3-chloro-4-fluorophenyl)sulfamoyl chloride?
The IUPAC name of N-(3-chloro-4-fluorophenyl)sulfamoyl chloride (CID 84760554) is N-(3-chloro-4-fluorophenyl)sulfamoyl chloride.
What is the SMILES notation for N-(3-chloro-4-fluorophenyl)sulfamoyl chloride?
The canonical SMILES for N-(3-chloro-4-fluorophenyl)sulfamoyl chloride is O=S(=O)(Cl)Nc1ccc(F)c(Cl)c1.
What is the InChIKey of N-(3-chloro-4-fluorophenyl)sulfamoyl chloride?
The InChIKey is LMJILKRFGBIXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2FNO2S/c7-5-3-4(1-2-6(5)9)10-13(8,11)12/h1-3,10H.
What are the key properties of N-(3-chloro-4-fluorophenyl)sulfamoyl chloride?
N-(3-chloro-4-fluorophenyl)sulfamoyl chloride has a molecular weight of 244.07 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-fluorophenyl)sulfamoyl chloride is sourced from PubChem (CID 84760554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).