C19H22BrFN2O4S — CID 51963337
5-bromo-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-methoxybenzenesulfonamide (PubChem CID 51963337) has the molecular formula C19H22BrFN2O4S and a molecular weight of 473.36 g/mol. Its IUPAC name is 5-bromo-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 51963337 |
| Molecular Formula | C19H22BrFN2O4S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 5-bromo-N-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)Nc1ccc(N2C[C@@H](C)O[C@H](C)C2)c(F)c1 |
| InChI | InChI=1S/C19H22BrFN2O4S/c1-12-10-23(11-13(2)27-12)17-6-5-15(9-16(17)21)22-28(24,25)19-8-14(20)4-7-18(19)26-3/h4-9,12-13,22H,10-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | XQSZLKOHPMLKBB-CHWSQXEVSA-N |
| XLogP | 4.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|