C21H28N4O3S — CID 60503346
N-(1-benzylpiperidin-3-yl)-5-morpholin-4-ylsulfonylpyridin-2-amine (PubChem CID 60503346) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-(1-benzylpiperidin-3-yl)-5-morpholin-4-ylsulfonylpyridin-2-amine.
| Compound Name | N-(1-benzylpiperidin-3-yl)-5-morpholin-4-ylsulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 60503346 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-(1-benzylpiperidin-3-yl)-5-morpholin-4-ylsulfonylpyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(NC2CCCN(Cc3ccccc3)C2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O3S/c26-29(27,25-11-13-28-14-12-25)20-8-9-21(22-15-20)23-19-7-4-10-24(17-19)16-18-5-2-1-3-6-18/h1-3,5-6,8-9,15,19H,4,7,10-14,16-17H2,(H,22,23) |
| InChIKey | GDDMSXVUMPVVMG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |