C15H17FN4O3S — CID 155510027
N-[2-(4-fluorophenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide (PubChem CID 155510027) has the molecular formula C15H17FN4O3S and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 155510027 |
| Molecular Formula | C15H17FN4O3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[2-(4-fluorophenyl)sulfonylethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)c1ccc(F)cc1)C1CCc2ncnn2C1 |
| InChI | InChI=1S/C15H17FN4O3S/c16-12-2-4-13(5-3-12)24(22,23)8-7-17-15(21)11-1-6-14-18-10-19-20(14)9-11/h2-5,10-11H,1,6-9H2,(H,17,21) |
| InChIKey | FAFKJVZKAORLOO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |