C17H15FN4O2 — CID 126767615
5-(4-fluorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)furan-2-carboxamide (PubChem CID 126767615) has the molecular formula C17H15FN4O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)furan-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 126767615 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)furan-2-carboxamide |
| SMILES | O=C(NC1CCc2ncnn2C1)c1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H15FN4O2/c18-12-3-1-11(2-4-12)14-6-7-15(24-14)17(23)21-13-5-8-16-19-10-20-22(16)9-13/h1-4,6-7,10,13H,5,8-9H2,(H,21,23) |
| InChIKey | UJTCYSWVXWHBFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |