C13H16N6O — CID 86804769
1-(5-methyl-2-pyridinyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 86804769) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-(5-methyl-2-pyridinyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-(5-methyl-2-pyridinyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 86804769 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-(5-methyl-2-pyridinyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CCc3ncnn3C2)nc1 |
| InChI | InChI=1S/C13H16N6O/c1-9-2-4-11(14-6-9)18-13(20)17-10-3-5-12-15-8-16-19(12)7-10/h2,4,6,8,10H,3,5,7H2,1H3,(H2,14,17,18,20) |
| InChIKey | YIPUGOODWNXMAU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |