C17H19N7OS — CID 126788231
1-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 126788231) has the molecular formula C17H19N7OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 1-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 126788231 |
| Molecular Formula | C17H19N7OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[5-[(4-methylphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | Cc1ccc(Cc2nnc(NC(=O)NC3CCc4ncnn4C3)s2)cc1 |
| InChI | InChI=1S/C17H19N7OS/c1-11-2-4-12(5-3-11)8-15-22-23-17(26-15)21-16(25)20-13-6-7-14-18-10-19-24(14)9-13/h2-5,10,13H,6-9H2,1H3,(H2,20,21,23,25) |
| InChIKey | XFDLSVKRGUYTIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |