C13H12F3N5O — CID 99631930
1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 99631930) has the molecular formula C13H12F3N5O and a molecular weight of 311.27 g/mol. Its IUPAC name is 1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 99631930 |
| Molecular Formula | C13H12F3N5O |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)c(F)cc1F)N[C@@H]1CCc2ncnn2C1 |
| InChI | InChI=1S/C13H12F3N5O/c14-8-3-10(16)11(4-9(8)15)20-13(22)19-7-1-2-12-17-6-18-21(12)5-7/h3-4,6-7H,1-2,5H2,(H2,19,20,22)/t7-/m1/s1 |
| InChIKey | NVRCMZNDKPOYSI-SSDOTTSWSA-N |
| XLogP | 1.83 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|