C13H13ClFN5O — CID 86804730
1-(3-chloro-5-fluorophenyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 86804730) has the molecular formula C13H13ClFN5O and a molecular weight of 309.73 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 86804730 |
| Molecular Formula | C13H13ClFN5O |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | O=C(Nc1cc(F)cc(Cl)c1)NC1CCc2ncnn2C1 |
| InChI | InChI=1S/C13H13ClFN5O/c14-8-3-9(15)5-11(4-8)19-13(21)18-10-1-2-12-16-7-17-20(12)6-10/h3-5,7,10H,1-2,6H2,(H2,18,19,21) |
| InChIKey | ABYIVAJSZBCAPG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |