C19H24ClN5O — CID 170579337
1-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea (PubChem CID 170579337) has the molecular formula C19H24ClN5O and a molecular weight of 373.89 g/mol. Its IUPAC name is 1-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea.
| Compound Name | 1-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 170579337 |
| Molecular Formula | C19H24ClN5O |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[(S)-(3-chlorophenyl)-cyclopentylmethyl]-3-[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]urea |
| SMILES | O=C(N[C@@H]1CCc2ncnn2C1)N[C@H](c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C19H24ClN5O/c20-15-7-3-6-14(10-15)18(13-4-1-2-5-13)24-19(26)23-16-8-9-17-21-12-22-25(17)11-16/h3,6-7,10,12-13,16,18H,1-2,4-5,8-9,11H2,(H2,23,24,26)/t16-,18+/m1/s1 |
| InChIKey | QJHLPUHPTSPRGM-AEFFLSMTSA-N |
| XLogP | 3.48 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |