C17H16F3N7O — CID 75512170
1-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea (PubChem CID 75512170) has the molecular formula C17H16F3N7O and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea.
| Compound Name | 1-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
|---|---|
| PubChem CID | 75512170 |
| Molecular Formula | C17H16F3N7O |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1-n1cccn1)NC1CCc2ncnn2C1 |
| InChI | InChI=1S/C17H16F3N7O/c18-17(19,20)11-2-4-14(26-7-1-6-22-26)13(8-11)25-16(28)24-12-3-5-15-21-10-23-27(15)9-12/h1-2,4,6-8,10,12H,3,5,9H2,(H2,24,25,28) |
| InChIKey | NBLICYUZTXJVTK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |