C14H17ClN6O — CID 95333583
(2R)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propanamide (PubChem CID 95333583) has the molecular formula C14H17ClN6O and a molecular weight of 320.78 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propanamide |
|---|---|
| PubChem CID | 95333583 |
| Molecular Formula | C14H17ClN6O |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]propanamide |
| SMILES | C[C@@H](N[C@H]1CCc2ncnn2C1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H17ClN6O/c1-9(14(22)20-12-4-2-10(15)6-16-12)19-11-3-5-13-17-8-18-21(13)7-11/h2,4,6,8-9,11,19H,3,5,7H2,1H3,(H,16,20,22)/t9-,11+/m1/s1 |
| InChIKey | KJKZFHYQEISTRK-KOLCDFICSA-N |
| XLogP | 1.26 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |