C15H19ClN6O — CID 95607539
(2S)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methylamino]propanamide (PubChem CID 95607539) has the molecular formula C15H19ClN6O and a molecular weight of 334.81 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methylamino]propanamide.
| Compound Name | (2S)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methylamino]propanamide |
|---|---|
| PubChem CID | 95607539 |
| Molecular Formula | C15H19ClN6O |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (2S)-N-(5-chloro-2-pyridinyl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methylamino]propanamide |
| SMILES | C[C@H](NC[C@@H]1CCc2nncn2C1)C(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H19ClN6O/c1-10(15(23)20-13-4-3-12(16)7-18-13)17-6-11-2-5-14-21-19-9-22(14)8-11/h3-4,7,9-11,17H,2,5-6,8H2,1H3,(H,18,20,23)/t10-,11-/m0/s1 |
| InChIKey | HSDABZIDLYXBAN-QWRGUYRKSA-N |
| XLogP | 1.51 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |