C16H22FIN6O — CID 119152630
1-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 119152630) has the molecular formula C16H22FIN6O and a molecular weight of 460.30 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119152630 |
| Molecular Formula | C16H22FIN6O |
| Molecular Weight | 460.30 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-hydroxyethyl]-2-methyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)c1ccc(F)cc1)NC1CCc2ncnn2C1.I |
| InChI | InChI=1S/C16H21FN6O.HI/c1-18-16(19-8-14(24)11-2-4-12(17)5-3-11)22-13-6-7-15-20-10-21-23(15)9-13;/h2-5,10,13-14,24H,6-9H2,1H3,(H2,18,19,22);1H |
| InChIKey | REWXDENNTLDBQF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|