C20H21FN2O2 — CID 146189334
tert-butyl N-[[2-(4-fluoro-1H-indol-2-yl)phenyl]methyl]carbamate (PubChem CID 146189334) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is tert-butyl N-[[2-(4-fluoro-1H-indol-2-yl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4-fluoro-1H-indol-2-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 146189334 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | tert-butyl N-[[2-(4-fluoro-1H-indol-2-yl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccccc1-c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C20H21FN2O2/c1-20(2,3)25-19(24)22-12-13-7-4-5-8-14(13)18-11-15-16(21)9-6-10-17(15)23-18/h4-11,23H,12H2,1-3H3,(H,22,24) |
| InChIKey | NZAXLIGVHGBXHC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |