C15H18ClNO3 — CID 164866599
tert-butyl N-[(5-chloro-3-methyl-1-benzofuran-2-yl)methyl]carbamate (PubChem CID 164866599) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is tert-butyl N-[(5-chloro-3-methyl-1-benzofuran-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-chloro-3-methyl-1-benzofuran-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 164866599 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl N-[(5-chloro-3-methyl-1-benzofuran-2-yl)methyl]carbamate |
| SMILES | Cc1c(CNC(=O)OC(C)(C)C)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H18ClNO3/c1-9-11-7-10(16)5-6-12(11)19-13(9)8-17-14(18)20-15(2,3)4/h5-7H,8H2,1-4H3,(H,17,18) |
| InChIKey | ZBRDUXPHLUGEEJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |