C15H19ClN2O2 — CID 125440613
(2R)-N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 125440613) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (2R)-N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | (2R)-N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 125440613 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (2R)-N-[(5-chloro-2-propan-2-yloxyphenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)Oc1ccc(Cl)cc1CNC(=O)[C@H]1C=CCN1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-10(2)20-14-6-5-12(16)8-11(14)9-18-15(19)13-4-3-7-17-13/h3-6,8,10,13,17H,7,9H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | BEHBUKCZOHGLEQ-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|