C14H29N3O4 — CID 103390878
tert-butyl N-[2-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propyl]carbamate (PubChem CID 103390878) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103390878 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | tert-butyl N-[2-[[3-(2-methoxyethylamino)-3-oxopropyl]amino]propyl]carbamate |
| SMILES | COCCNC(=O)CCNC(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29N3O4/c1-11(10-17-13(19)21-14(2,3)4)15-7-6-12(18)16-8-9-20-5/h11,15H,6-10H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | WNUBYPVXPHUTHK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|