C26H41NO6 — CID 130187796
methyl 3-[4-[(8-methoxy-8-oxooctyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]benzoate (PubChem CID 130187796) has the molecular formula C26H41NO6 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl 3-[4-[(8-methoxy-8-oxooctyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]benzoate.
| Compound Name | methyl 3-[4-[(8-methoxy-8-oxooctyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]benzoate |
|---|---|
| PubChem CID | 130187796 |
| Molecular Formula | C26H41NO6 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | methyl 3-[4-[(8-methoxy-8-oxooctyl)-[(2-methylpropan-2-yl)oxycarbonyl]amino]butyl]benzoate |
| SMILES | COC(=O)CCCCCCCN(CCCCc1cccc(C(=O)OC)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H41NO6/c1-26(2,3)33-25(30)27(18-11-8-6-7-9-17-23(28)31-4)19-12-10-14-21-15-13-16-22(20-21)24(29)32-5/h13,15-16,20H,6-12,14,17-19H2,1-5H3 |
| InChIKey | SWKLCQPCXTXMES-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|