C23H25NO6 — CID 168915325
tert-butyl 3-(3-methoxy-3-oxopropyl)benzoate;isoindole-1,3-dione (PubChem CID 168915325) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is tert-butyl 3-(3-methoxy-3-oxopropyl)benzoate;isoindole-1,3-dione.
| Compound Name | tert-butyl 3-(3-methoxy-3-oxopropyl)benzoate;isoindole-1,3-dione |
|---|---|
| PubChem CID | 168915325 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl 3-(3-methoxy-3-oxopropyl)benzoate;isoindole-1,3-dione |
| SMILES | COC(=O)CCc1cccc(C(=O)OC(C)(C)C)c1.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H20O4.C8H5NO2/c1-15(2,3)19-14(17)12-7-5-6-11(10-12)8-9-13(16)18-4;10-7-5-3-1-2-4-6(5)8(11)9-7/h5-7,10H,8-9H2,1-4H3;1-4H,(H,9,10,11) |
| InChIKey | CEGFOGSUXUASTD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|