C25H32N2O6 — CID 168915418
tert-butyl 3-[3-(methoxyamino)-3-oxopropyl]benzoate;ethane;isoindole-1,3-dione (PubChem CID 168915418) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl 3-[3-(methoxyamino)-3-oxopropyl]benzoate;ethane;isoindole-1,3-dione.
| Compound Name | tert-butyl 3-[3-(methoxyamino)-3-oxopropyl]benzoate;ethane;isoindole-1,3-dione |
|---|---|
| PubChem CID | 168915418 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | tert-butyl 3-[3-(methoxyamino)-3-oxopropyl]benzoate;ethane;isoindole-1,3-dione |
| SMILES | CC.CONC(=O)CCc1cccc(C(=O)OC(C)(C)C)c1.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C15H21NO4.C8H5NO2.C2H6/c1-15(2,3)20-14(18)12-7-5-6-11(10-12)8-9-13(17)16-19-4;10-7-5-3-1-2-4-6(5)8(11)9-7;1-2/h5-7,10H,8-9H2,1-4H3,(H,16,17);1-4H,(H,9,10,11);1-2H3 |
| InChIKey | SBSCSNYQVXWOND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|