C31H39NO4 — CID 144925537
tert-butyl 2-[4-[[3-(3-methoxycarbonylphenyl)propylamino]methyl]phenyl]benzoate;ethane (PubChem CID 144925537) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is tert-butyl 2-[4-[[3-(3-methoxycarbonylphenyl)propylamino]methyl]phenyl]benzoate;ethane.
| Compound Name | tert-butyl 2-[4-[[3-(3-methoxycarbonylphenyl)propylamino]methyl]phenyl]benzoate;ethane |
|---|---|
| PubChem CID | 144925537 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | tert-butyl 2-[4-[[3-(3-methoxycarbonylphenyl)propylamino]methyl]phenyl]benzoate;ethane |
| SMILES | CC.COC(=O)c1cccc(CCCNCc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C29H33NO4.C2H6/c1-29(2,3)34-28(32)26-13-6-5-12-25(26)23-16-14-22(15-17-23)20-30-18-8-10-21-9-7-11-24(19-21)27(31)33-4;1-2/h5-7,9,11-17,19,30H,8,10,18,20H2,1-4H3;1-2H3 |
| InChIKey | XVZXNXTWTOAQAK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|