C24H32F2N6OS — CID 19097544
3-(2,4-difluorophenyl)-1-heptyl-1-(5-purin-9-ylsulfanylpentyl)urea (PubChem CID 19097544) has the molecular formula C24H32F2N6OS and a molecular weight of 490.62 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-heptyl-1-(5-purin-9-ylsulfanylpentyl)urea.
| Compound Name | 3-(2,4-difluorophenyl)-1-heptyl-1-(5-purin-9-ylsulfanylpentyl)urea |
|---|---|
| PubChem CID | 19097544 |
| Molecular Formula | C24H32F2N6OS |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-heptyl-1-(5-purin-9-ylsulfanylpentyl)urea |
| SMILES | CCCCCCCN(CCCCCSn1cnc2cncnc21)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C24H32F2N6OS/c1-2-3-4-5-7-12-31(24(33)30-21-11-10-19(25)15-20(21)26)13-8-6-9-14-34-32-18-29-22-16-27-17-28-23(22)32/h10-11,15-18H,2-9,12-14H2,1H3,(H,30,33) |
| InChIKey | MMQJPOCRSQBDAL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|