C35H40F2N4O3S — CID 10416627
3-(2,4-difluorophenyl)-1-[5-(13,15-dioxa-3,5-diazatetracyclo[14.4.0.02,6.07,12]icosa-1(20),2(6),3,7,9,11,16,18-octaen-4-ylsulfanyl)pentyl]-1-heptylurea (PubChem CID 10416627) has the molecular formula C35H40F2N4O3S and a molecular weight of 634.79 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-1-[5-(13,15-dioxa-3,5-diazatetracyclo[14.4.0.02,6.07,12]icosa-1(20),2(6),3,7,9,11,16,18-octaen-4-ylsulfanyl)pentyl]-1-heptylurea.
| Compound Name | 3-(2,4-difluorophenyl)-1-[5-(13,15-dioxa-3,5-diazatetracyclo[14.4.0.02,6.07,12]icosa-1(20),2(6),3,7,9,11,16,18-octaen-4-ylsulfanyl)pentyl]-1-heptylurea |
|---|---|
| PubChem CID | 10416627 |
| Molecular Formula | C35H40F2N4O3S |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | 3-(2,4-difluorophenyl)-1-[5-(13,15-dioxa-3,5-diazatetracyclo[14.4.0.02,6.07,12]icosa-1(20),2(6),3,7,9,11,16,18-octaen-4-ylsulfanyl)pentyl]-1-heptylurea |
| SMILES | CCCCCCCN(CCCCCSc1nc2c([nH]1)-c1ccccc1OCOc1ccccc1-2)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C35H40F2N4O3S/c1-2-3-4-5-11-20-41(35(42)38-29-19-18-25(36)23-28(29)37)21-12-6-13-22-45-34-39-32-26-14-7-9-16-30(26)43-24-44-31-17-10-8-15-27(31)33(32)40-34/h7-10,14-19,23H,2-6,11-13,20-22,24H2,1H3,(H,38,42)(H,39,40) |
| InChIKey | CJGCUCYNYNHHAJ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|